CAS 215530-62-4 is the registry number for 6-Chloro-(1,2,4)triazolo(1,5-b)pyridazine-2-carboxylic acid, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
6-chloro-[1,2,4]triazolo[1,5-b]pyridazine-2-carboxylic acid (CAS 215530-62-4) is a chemical compound with the molecular formula C6H3ClN4O2 and a molecular weight of 198.57 g/mol. IUPAC name: 6-chloro-[1,2,4]triazolo[1,5-b]pyridazine-2-carboxylic acid. InChIKey: FTZDILJQOJEYLX-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN4O2 |
|---|---|
| Molecular weight | 198.57 g/mol |
| IUPAC name | 6-chloro-[1,2,4]triazolo[1,5-b]pyridazine-2-carboxylic acid |
| InChIKey | FTZDILJQOJEYLX-UHFFFAOYSA-N |
| SMILES | C1=CC(=NN2C1=NC(=N2)C(=O)O)Cl |
Computed by PubChem (NCBI)