CAS 18087-76-8 appears in our catalog under these names: 6–Chloro–3–nitro–imidazo(1,2–b)pyridazine, 6-Chloro-3-nitroimidazo[1,2-b]pyridazine 97%, 6-Chloro-3-nitroimidazo[1,2-b]pyridazine, 98%, 98%, 6-Chloro-3-nitroimidazo[1,2-b]pyridazine, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 50g, 5g, 250mg, 1g, 10g.
6-chloro-3-nitroimidazo[1,2-b]pyridazine (CAS 18087-76-8) is a chemical compound with the molecular formula C6H3ClN4O2 and a molecular weight of 198.57 g/mol. IUPAC name: 6-chloro-3-nitroimidazo[1,2-b]pyridazine. InChIKey: IJEZMDPWGDWYKJ-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN4O2 |
|---|---|
| Molecular weight | 198.57 g/mol |
| IUPAC name | 6-chloro-3-nitroimidazo[1,2-b]pyridazine |
| InChIKey | IJEZMDPWGDWYKJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NN2C1=NC=C2[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)