CAS 136443-08-8 is the registry number for 4-ethynyl-alpha,alpha-diphenyl-Benzenemethanol. Offered by: TRC. Available pack sizes: 1g.
(4-ethynylphenyl)-diphenylmethanol (CAS 136443-08-8) is a chemical compound with the molecular formula C21H16O and a molecular weight of 284.3 g/mol. IUPAC name: (4-ethynylphenyl)-diphenylmethanol. InChIKey: TTYBGMUDYSDEID-UHFFFAOYSA-N.
| Molecular formula | C21H16O |
|---|---|
| Molecular weight | 284.3 g/mol |
| IUPAC name | (4-ethynylphenyl)-diphenylmethanol |
| InChIKey | TTYBGMUDYSDEID-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)O |
Computed by PubChem (NCBI)