CAS 1374677-48-1 is the registry number for 7,7-Dimethyl-7H-fluoreno[4,3-b]benzofuran, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7,7-dimethylfluoreno[4,3-b][1]benzofuran (CAS 1374677-48-1) is a chemical compound with the molecular formula C21H16O and a molecular weight of 284.3 g/mol. IUPAC name: 7,7-dimethylfluoreno[4,3-b][1]benzofuran. InChIKey: DGJATZTWYHMUQH-UHFFFAOYSA-N.
| Molecular formula | C21H16O |
|---|---|
| Molecular weight | 284.3 g/mol |
| IUPAC name | 7,7-dimethylfluoreno[4,3-b][1]benzofuran |
| InChIKey | DGJATZTWYHMUQH-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C3=CC=CC=C31)C4=C(C=C2)C5=CC=CC=C5O4)C |
Computed by PubChem (NCBI)