CAS 849-01-4 appears in our catalog under these names: beta-Phenylchalkone, 1,3,3-Triphenyl-2-propen-1-one, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
1,3,3-triphenylprop-2-en-1-one (CAS 849-01-4) is a chemical compound with the molecular formula C21H16O and a molecular weight of 284.3 g/mol. IUPAC name: 1,3,3-triphenylprop-2-en-1-one. InChIKey: PTKAYCBILQSQRK-UHFFFAOYSA-N.
| Molecular formula | C21H16O |
|---|---|
| Molecular weight | 284.3 g/mol |
| IUPAC name | 1,3,3-triphenylprop-2-en-1-one |
| InChIKey | PTKAYCBILQSQRK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=CC(=O)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)