CAS 3342-98-1 is the registry number for 1-Hydroxy-3-methylcholanthrene. Offered by: TRC. Available pack sizes: 50mg.
3-methyl-1,2-dihydrobenzo[j]aceanthrylen-1-ol (CAS 3342-98-1) is a chemical compound with the molecular formula C21H16O and a molecular weight of 284.3 g/mol. IUPAC name: 3-methyl-1,2-dihydrobenzo[j]aceanthrylen-1-ol. InChIKey: CHNZFZQGTXDBFI-UHFFFAOYSA-N.
| Molecular formula | C21H16O |
|---|---|
| Molecular weight | 284.3 g/mol |
| IUPAC name | 3-methyl-1,2-dihydrobenzo[j]aceanthrylen-1-ol |
| InChIKey | CHNZFZQGTXDBFI-UHFFFAOYSA-N |
| SMILES | CC1=C2CC(C3=C2C(=CC4=C3C=CC5=CC=CC=C54)C=C1)O |
Computed by PubChem (NCBI)