CAS 62784-66-1 appears in our catalog under these names: Di–1–naphthylmethanol, DI-1-NAPHTHYLMETHANOL, 98%, Di-1-naphthylmethanol, >98.0%(HPLC), Di(naphthalen-1-yl)methanol 98%, Di(naphthalen-1-yl)methanol, 98%, 98%. Offered by: GLPBio, Fluorochem, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 250mg, 10g.
Dinaphthalen-1-ylmethanol (CAS 62784-66-1) is a chemical compound with the molecular formula C21H16O and a molecular weight of 284.3 g/mol. IUPAC name: dinaphthalen-1-ylmethanol. InChIKey: NHIXQVYVFRYTOB-UHFFFAOYSA-N.
| Molecular formula | C21H16O |
|---|---|
| Molecular weight | 284.3 g/mol |
| IUPAC name | dinaphthalen-1-ylmethanol |
| InChIKey | NHIXQVYVFRYTOB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C(C3=CC=CC4=CC=CC=C43)O |
Computed by PubChem (NCBI)