CAS 25683-83-4 appears in our catalog under these names: α-(Diphenylmethylene)benzeneacetaldehyde, 98%, 98%, 2,3,3-Triphenylacrylaldehyde, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
2,3,3-triphenylprop-2-enal (CAS 25683-83-4) is a chemical compound with the molecular formula C21H16O and a molecular weight of 284.3 g/mol. IUPAC name: 2,3,3-triphenylprop-2-enal. InChIKey: IOLTUHQRLOBELW-UHFFFAOYSA-N.
| Molecular formula | C21H16O |
|---|---|
| Molecular weight | 284.3 g/mol |
| IUPAC name | 2,3,3-triphenylprop-2-enal |
| InChIKey | IOLTUHQRLOBELW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC=CC=C3)C=O |
Computed by PubChem (NCBI)