Products 136562-77-1
CAS 136562-77-1 is the registry number for 3-oxo-3-(4-phenoxyphenyl)propanenitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
3-oxo-3-(4-phenoxyphenyl)propanenitrile (CAS 136562-77-1) is a chemical compound with the molecular formula C15H11NO2 and a molecular weight of 237.25 g/mol. IUPAC name: 3-oxo-3-(4-phenoxyphenyl)propanenitrile. InChIKey: VKFAKXHYJOEGTR-UHFFFAOYSA-N.
| Molecular formula | C15H11NO2 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 3-oxo-3-(4-phenoxyphenyl)propanenitrile |
| InChIKey | VKFAKXHYJOEGTR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C(=O)CC#N |
Computed by PubChem (NCBI)