Products 1366179-39-6
CAS 1366179-39-6 is the registry number for Dechloro Asenapine Ethanedioate. Offered by: TRC. Available pack sizes: 100mg.
(2R,6R)-4-methyl-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaene;oxalic acid (CAS 1366179-39-6) is a chemical compound with the molecular formula C19H19NO5 and a molecular weight of 341.4 g/mol. IUPAC name: (2R,6R)-4-methyl-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaene;oxalic acid. InChIKey: KOKDXGWEPSYGBZ-YYLIZZNMSA-N.
| Molecular formula | C19H19NO5 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | (2R,6R)-4-methyl-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaene;oxalic acid |
| InChIKey | KOKDXGWEPSYGBZ-YYLIZZNMSA-N |
| SMILES | CN1C[C@@H]2[C@@H](C1)C3=CC=CC=C3OC4=CC=CC=C24.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Dechloro Asenapine Ethanedioate