CAS 1367976-16-6 appears in our catalog under these names: 2-(4-Amino-2H-1,2,3-triazol-2-yl)-3-methylbutanoic acid, 95%, 2-(4-Amino-2H-1,2,3-triazol-2-yl)-3-methylbutanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(4-aminotriazol-2-yl)-3-methylbutanoic acid (CAS 1367976-16-6) is a chemical compound with the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. IUPAC name: 2-(4-aminotriazol-2-yl)-3-methylbutanoic acid. InChIKey: QBFLIUCCIAAQCM-UHFFFAOYSA-N.
| Molecular formula | C7H12N4O2 |
|---|---|
| Molecular weight | 184.20 g/mol |
| IUPAC name | 2-(4-aminotriazol-2-yl)-3-methylbutanoic acid |
| InChIKey | QBFLIUCCIAAQCM-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)N1N=CC(=N1)N |
Computed by PubChem (NCBI)