CAS 1367992-14-0 is the registry number for 4-(1-Methyl-1H-pyrazol-4-yl)pyridin-3-amine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-(1-methylpyrazol-4-yl)pyridin-3-amine (CAS 1367992-14-0) is a chemical compound with the molecular formula C9H10N4 and a molecular weight of 174.20 g/mol. IUPAC name: 4-(1-methylpyrazol-4-yl)pyridin-3-amine. InChIKey: FVDASHAOZBEVIK-UHFFFAOYSA-N.
| Molecular formula | C9H10N4 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 4-(1-methylpyrazol-4-yl)pyridin-3-amine |
| InChIKey | FVDASHAOZBEVIK-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=C(C=NC=C2)N |
Computed by PubChem (NCBI)