CAS 1368259-20-4 appears in our catalog under these names: 3-(Quinolin-7-yl)propanoic acid, 95%, 3-(Quinolin-7-yl)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-quinolin-7-ylpropanoic acid (CAS 1368259-20-4) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 3-quinolin-7-ylpropanoic acid. InChIKey: FURFVKMNVNSHFC-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 3-quinolin-7-ylpropanoic acid |
| InChIKey | FURFVKMNVNSHFC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)CCC(=O)O)N=C1 |
Computed by PubChem (NCBI)