Products 1368620-03-4
CAS 1368620-03-4 is the registry number for 3,3-Dimethyl-2-oxo-1,2,3,4-tetrahydroquinoline-6-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3,3-dimethyl-2-oxo-1,4-dihydroquinoline-6-sulfonyl chloride (CAS 1368620-03-4) is a chemical compound with the molecular formula C11H12ClNO3S and a molecular weight of 273.74 g/mol. IUPAC name: 3,3-dimethyl-2-oxo-1,4-dihydroquinoline-6-sulfonyl chloride. InChIKey: VUXLVVDLLQRTCD-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO3S |
|---|---|
| Molecular weight | 273.74 g/mol |
| IUPAC name | 3,3-dimethyl-2-oxo-1,4-dihydroquinoline-6-sulfonyl chloride |
| InChIKey | VUXLVVDLLQRTCD-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C=CC(=C2)S(=O)(=O)Cl)NC1=O)C |
Computed by PubChem (NCBI)