Products 1368620-03-4

CAS 1368620-03-4 is the registry number for 3,3-Dimethyl-2-oxo-1,2,3,4-tetrahydroquinoline-6-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3,3-dimethyl-2-oxo-1,4-dihydroquinoline-6-sulfonyl chloride (CAS 1368620-03-4) is a chemical compound with the molecular formula C11H12ClNO3S and a molecular weight of 273.74 g/mol. IUPAC name: 3,3-dimethyl-2-oxo-1,4-dihydroquinoline-6-sulfonyl chloride. InChIKey: VUXLVVDLLQRTCD-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12ClNO3S
Molecular weight273.74 g/mol
IUPAC name3,3-dimethyl-2-oxo-1,4-dihydroquinoline-6-sulfonyl chloride
InChIKeyVUXLVVDLLQRTCD-UHFFFAOYSA-N
SMILESCC1(CC2=C(C=CC(=C2)S(=O)(=O)Cl)NC1=O)C

Computed by PubChem (NCBI)