CAS 136868-91-2 is the registry number for Bis(p-cresyl) m-Cresyl Phosphate. Offered by: TRC. Available pack sizes: 2,5g.
(3-methylphenyl) bis(4-methylphenyl) phosphate (CAS 136868-91-2) is a chemical compound with the molecular formula C21H21O4P and a molecular weight of 368.4 g/mol. IUPAC name: (3-methylphenyl) bis(4-methylphenyl) phosphate. InChIKey: YSLTUIZNWYDWRT-UHFFFAOYSA-N.
| Molecular formula | C21H21O4P |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | (3-methylphenyl) bis(4-methylphenyl) phosphate |
| InChIKey | YSLTUIZNWYDWRT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OP(=O)(OC2=CC=C(C=C2)C)OC3=CC=CC(=C3)C |
Computed by PubChem (NCBI)