CAS 1369032-12-1 appears in our catalog under these names: 2-Benzyl-5-bromo-1,3,4-oxadiazole, 95%, 2-Benzyl-5-bromo-1,3,4-oxadiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-benzyl-5-bromo-1,3,4-oxadiazole (CAS 1369032-12-1) is a chemical compound with the molecular formula C9H7BrN2O and a molecular weight of 239.07 g/mol. IUPAC name: 2-benzyl-5-bromo-1,3,4-oxadiazole. InChIKey: MSNCWUCCJOJOGX-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 2-benzyl-5-bromo-1,3,4-oxadiazole |
| InChIKey | MSNCWUCCJOJOGX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NN=C(O2)Br |
Computed by PubChem (NCBI)