CAS 1369423-51-7 appears in our catalog under these names: (2R)-2-Amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid, 95%, Methyldopa EP Impurity D HCl (Carbidopa Impurity 3 HCl), (R)–2–Amino–3–(3,4–dihydroxyphenyl)–2–methylpropanoic acid hydrochloride, (R)-2-Amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid hydrochloride, 98%, 98%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Chemat. Available pack sizes: 100mg, 1g, on request, 250mg.
(2R)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid;hydrochloride (CAS 1369423-51-7) is a chemical compound with the molecular formula C10H14ClNO4 and a molecular weight of 247.67 g/mol. IUPAC name: (2R)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid;hydrochloride. InChIKey: NLRUDGHSXOEXCE-HNCPQSOCSA-N.
| Molecular formula | C10H14ClNO4 |
|---|---|
| Molecular weight | 247.67 g/mol |
| IUPAC name | (2R)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid;hydrochloride |
| InChIKey | NLRUDGHSXOEXCE-HNCPQSOCSA-N |
| SMILES | C[C@@](CC1=CC(=C(C=C1)O)O)(C(=O)O)N.Cl |
Computed by PubChem (NCBI)