CAS 2137451-44-4 is the registry number for 2-Amino-2-(2,4-dimethoxyphenyl)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g.
2-amino-2-(2,4-dimethoxyphenyl)acetic acid;hydrochloride (CAS 2137451-44-4) is a chemical compound with the molecular formula C10H14ClNO4 and a molecular weight of 247.67 g/mol. IUPAC name: 2-amino-2-(2,4-dimethoxyphenyl)acetic acid;hydrochloride. InChIKey: DCBDCLOIRACMKS-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO4 |
|---|---|
| Molecular weight | 247.67 g/mol |
| IUPAC name | 2-amino-2-(2,4-dimethoxyphenyl)acetic acid;hydrochloride |
| InChIKey | DCBDCLOIRACMKS-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(C(=O)O)N)OC.Cl |
Computed by PubChem (NCBI)