CAS 91013-37-5 appears in our catalog under these names: 2-Amino-3-(4-hydroxy-3-methoxy-phenyl)-propionic acid hydrochloride, 98%, Levodopa EP Impurity C HCl (Levodopa USP Related Compound B HCl, DL-3-O-Methyldopa HCl), 3-Methoxytyrosine hydrochloride, >95% (HPLC), 2-Amino-3-(4-hydroxy-3-methoxyphenyl)propanoic acid hydrochloride, 2-Amino-3-(4-hydroxy-3-methoxyphenyl)propanoic acid hydrochloride, 98%, 98%. Offered by: Combi-blocks, Chemat Brand, TRC, Biosynth, Chemat. Available pack sizes: 10g, 5g, 1g, on request, 100mg.
2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoic acid;hydrochloride (CAS 91013-37-5) is a chemical compound with the molecular formula C10H14ClNO4 and a molecular weight of 247.67 g/mol. IUPAC name: 2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoic acid;hydrochloride. InChIKey: UNETXNZYVGKTSS-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO4 |
|---|---|
| Molecular weight | 247.67 g/mol |
| IUPAC name | 2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoic acid;hydrochloride |
| InChIKey | UNETXNZYVGKTSS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)CC(C(=O)O)N)O.Cl |
Computed by PubChem (NCBI)