Products 1779441-65-4
CAS 1779441-65-4 appears in our catalog under these names: 2-Amino-4-hydroxy-4-(3-hydroxyphenyl)butanoic acid hydrochloride, 95%+, 2-Amino-4-hydroxy-4-(3-hydroxyphenyl)butanoic acid hydrochloride, 95%+, 95%+. Offered by: Fluorochem, Chemat. Available pack sizes: 10mg.
2-amino-4-hydroxy-4-(3-hydroxyphenyl)butanoic acid;hydrochloride (CAS 1779441-65-4) is a chemical compound with the molecular formula C10H14ClNO4 and a molecular weight of 247.67 g/mol. IUPAC name: 2-amino-4-hydroxy-4-(3-hydroxyphenyl)butanoic acid;hydrochloride. InChIKey: HNVAJVKJLCHAAU-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO4 |
|---|---|
| Molecular weight | 247.67 g/mol |
| IUPAC name | 2-amino-4-hydroxy-4-(3-hydroxyphenyl)butanoic acid;hydrochloride |
| InChIKey | HNVAJVKJLCHAAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C(CC(C(=O)O)N)O.Cl |
Computed by PubChem (NCBI)