CAS 1607016-37-4 appears in our catalog under these names: Methyl 2-amino-2-(3-hydroxy-4-methoxyphenyl)acetate hydrochloride, 95%, Methyl 2-amino-2-(3-hydroxy-4-methoxyphenyl)acetate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 2-amino-2-(3-hydroxy-4-methoxyphenyl)acetate;hydrochloride (CAS 1607016-37-4) is a chemical compound with the molecular formula C10H14ClNO4 and a molecular weight of 247.67 g/mol. IUPAC name: methyl 2-amino-2-(3-hydroxy-4-methoxyphenyl)acetate;hydrochloride. InChIKey: WMYMYJCNMAYKJK-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO4 |
|---|---|
| Molecular weight | 247.67 g/mol |
| IUPAC name | methyl 2-amino-2-(3-hydroxy-4-methoxyphenyl)acetate;hydrochloride |
| InChIKey | WMYMYJCNMAYKJK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(C(=O)OC)N)O.Cl |
Computed by PubChem (NCBI)