CAS 63302-24-9 is the registry number for (2S)-2-Amino-3-(4-hydroxy-3-methoxyphenyl)propanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(2S)-2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoic acid;hydrochloride (CAS 63302-24-9) is a chemical compound with the molecular formula C10H14ClNO4 and a molecular weight of 247.67 g/mol. IUPAC name: (2S)-2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoic acid;hydrochloride. InChIKey: UNETXNZYVGKTSS-FJXQXJEOSA-N.
| Molecular formula | C10H14ClNO4 |
|---|---|
| Molecular weight | 247.67 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoic acid;hydrochloride |
| InChIKey | UNETXNZYVGKTSS-FJXQXJEOSA-N |
| SMILES | COC1=C(C=CC(=C1)C[C@@H](C(=O)O)N)O.Cl |
Computed by PubChem (NCBI)