Products 136949-71-8
CAS 136949-71-8 is the registry number for 5-Chloro-8-methoxy-3,4-dihydronaphthalen-2(1H)-one, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-8-methoxy-3,4-dihydro-1H-naphthalen-2-one (CAS 136949-71-8) is a chemical compound with the molecular formula C11H11ClO2 and a molecular weight of 210.65 g/mol. IUPAC name: 5-chloro-8-methoxy-3,4-dihydro-1H-naphthalen-2-one. InChIKey: TYYGBVYIWWOBMR-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO2 |
|---|---|
| Molecular weight | 210.65 g/mol |
| IUPAC name | 5-chloro-8-methoxy-3,4-dihydro-1H-naphthalen-2-one |
| InChIKey | TYYGBVYIWWOBMR-UHFFFAOYSA-N |
| SMILES | COC1=C2CC(=O)CCC2=C(C=C1)Cl |
Computed by PubChem (NCBI)