Products 1373232-85-9
CAS 1373232-85-9 appears in our catalog under these names: 3-Amino-4-(carboxymethyl)benzoic acid, 96%, Nintedanib Impurity 52, 3-Amino-4-(carboxymethyl)benzoic Acid. Offered by: Combi-blocks, Chemat Brand, TRC. Available pack sizes: 5g, 1g, on request, 250mg.
3-amino-4-(carboxymethyl)benzoic acid (CAS 1373232-85-9) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 3-amino-4-(carboxymethyl)benzoic acid. InChIKey: AWEAADJNCLTMMV-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 3-amino-4-(carboxymethyl)benzoic acid |
| InChIKey | AWEAADJNCLTMMV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)N)CC(=O)O |
Computed by PubChem (NCBI)