Products 1373929-42-0
CAS 1373929-42-0 appears in our catalog under these names: (E)-4,4'-(Diazene-1,2-diyl)bis(2-methylbenzoic acid), 95%, 95%, (E)-4,4'-(Diazene-1,2-diyl)bis(2-methylbenzoic acid), 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-[(4-carboxy-3-methylphenyl)diazenyl]-2-methylbenzoic acid (CAS 1373929-42-0) is a chemical compound with the molecular formula C16H14N2O4 and a molecular weight of 298.29 g/mol. IUPAC name: 4-[(4-carboxy-3-methylphenyl)diazenyl]-2-methylbenzoic acid. InChIKey: UBTNPKFFJAIDOT-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O4 |
|---|---|
| Molecular weight | 298.29 g/mol |
| IUPAC name | 4-[(4-carboxy-3-methylphenyl)diazenyl]-2-methylbenzoic acid |
| InChIKey | UBTNPKFFJAIDOT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N=NC2=CC(=C(C=C2)C(=O)O)C)C(=O)O |
Computed by PubChem (NCBI)