CAS 137438-23-4 appears in our catalog under these names: 4-Chloro-7-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine, 95%, 4-Chloro-7-methyl-5,6,7,8-tetrahydrobenzo¬b|thieno¬2,3-d|pyr. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 5g.
4-chloro-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine (CAS 137438-23-4) is a chemical compound with the molecular formula C11H11ClN2S and a molecular weight of 238.74 g/mol. IUPAC name: 4-chloro-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine. InChIKey: ZSDWARZBRRSRLT-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2S |
|---|---|
| Molecular weight | 238.74 g/mol |
| IUPAC name | 4-chloro-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
| InChIKey | ZSDWARZBRRSRLT-UHFFFAOYSA-N |
| SMILES | CC1CCC2=C(C1)SC3=C2C(=NC=N3)Cl |
Computed by PubChem (NCBI)