Products 301858-86-6
CAS 301858-86-6 appears in our catalog under these names: 4-[(4-Chlorophenyl)thio]-3,5-dimethyl-1h-pyrazole, 95%, 4-((4-Chlorophenyl)thio)-3,5-dimethyl-1H-pyrazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 50mg, 0,5g.
4-(4-chlorophenyl)sulfanyl-3,5-dimethyl-1H-pyrazole (CAS 301858-86-6) is a chemical compound with the molecular formula C11H11ClN2S and a molecular weight of 238.74 g/mol. IUPAC name: 4-(4-chlorophenyl)sulfanyl-3,5-dimethyl-1H-pyrazole. InChIKey: FABJXTYEJRKXNN-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2S |
|---|---|
| Molecular weight | 238.74 g/mol |
| IUPAC name | 4-(4-chlorophenyl)sulfanyl-3,5-dimethyl-1H-pyrazole |
| InChIKey | FABJXTYEJRKXNN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)SC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)