CAS 938377-76-5 is the registry number for 2-(2-(2-Chlorophenyl)-1,3-thiazol-4-yl)ethan-1-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]ethanamine (CAS 938377-76-5) is a chemical compound with the molecular formula C11H11ClN2S and a molecular weight of 238.74 g/mol. IUPAC name: 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]ethanamine. InChIKey: IZKSIKDBLFJATG-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2S |
|---|---|
| Molecular weight | 238.74 g/mol |
| IUPAC name | 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]ethanamine |
| InChIKey | IZKSIKDBLFJATG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=CS2)CCN)Cl |
Computed by PubChem (NCBI)