Products 163275-26-1
CAS 163275-26-1 appears in our catalog under these names: 2-(2-Pyridinylamino)-benzenethiol Hydrochloride, 2-(2-Pyridinylamino)-benzenethiol. Offered by: TRC. Available pack sizes: 10g, 1g.
2-(pyridin-2-ylamino)benzenethiol;hydrochloride (CAS 163275-26-1) is a chemical compound with the molecular formula C11H11ClN2S and a molecular weight of 238.74 g/mol. IUPAC name: 2-(pyridin-2-ylamino)benzenethiol;hydrochloride. InChIKey: ANSPBXUUFFVFDK-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2S |
|---|---|
| Molecular weight | 238.74 g/mol |
| IUPAC name | 2-(pyridin-2-ylamino)benzenethiol;hydrochloride |
| InChIKey | ANSPBXUUFFVFDK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC2=CC=CC=N2)S.Cl |
Computed by PubChem (NCBI)