Products 313533-99-2
CAS 313533-99-2 appears in our catalog under these names: 4-(4-Chlorophenyl)-5-ethylthiazol-2-amine, 97%, 4-(4-Chlorophenyl)-5-ethyl-1,3-thiazol-2-amine, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-(4-chlorophenyl)-5-ethyl-1,3-thiazol-2-amine (CAS 313533-99-2) is a chemical compound with the molecular formula C11H11ClN2S and a molecular weight of 238.74 g/mol. IUPAC name: 4-(4-chlorophenyl)-5-ethyl-1,3-thiazol-2-amine. InChIKey: OHRVZSIATXAKGK-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2S |
|---|---|
| Molecular weight | 238.74 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-5-ethyl-1,3-thiazol-2-amine |
| InChIKey | OHRVZSIATXAKGK-UHFFFAOYSA-N |
| SMILES | CCC1=C(N=C(S1)N)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)