CAS 501349-36-6 is the registry number for 5-((3-Chloro-4-methylphenyl)methyl)-1,3-thiazol-2-amine. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
5-[(3-chloro-4-methylphenyl)methyl]-1,3-thiazol-2-amine (CAS 501349-36-6) is a chemical compound with the molecular formula C11H11ClN2S and a molecular weight of 238.74 g/mol. IUPAC name: 5-[(3-chloro-4-methylphenyl)methyl]-1,3-thiazol-2-amine. InChIKey: AVNGJGIMGFLQTR-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2S |
|---|---|
| Molecular weight | 238.74 g/mol |
| IUPAC name | 5-[(3-chloro-4-methylphenyl)methyl]-1,3-thiazol-2-amine |
| InChIKey | AVNGJGIMGFLQTR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)CC2=CN=C(S2)N)Cl |
Computed by PubChem (NCBI)