CAS 1374430-02-0 appears in our catalog under these names: 4,4,5,5–Tetramethyl–2–(4–propoxyphenyl)–1,3,2–dioxaborolane, 4-Propoxyphenylboronic acid pinacol ester, 98%, 98%, 4,4,5,5-Tetramethyl-2-(4-propoxyphenyl)-1,3,2-dioxaborolane, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g.
4,4,5,5-tetramethyl-2-(4-propoxyphenyl)-1,3,2-dioxaborolane (CAS 1374430-02-0) is a chemical compound with the molecular formula C15H23BO3 and a molecular weight of 262.15 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-propoxyphenyl)-1,3,2-dioxaborolane. InChIKey: APYMSUVACVNTKB-UHFFFAOYSA-N.
| Molecular formula | C15H23BO3 |
|---|---|
| Molecular weight | 262.15 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-propoxyphenyl)-1,3,2-dioxaborolane |
| InChIKey | APYMSUVACVNTKB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCCC |
Computed by PubChem (NCBI)