CAS 1375473-06-5 appears in our catalog under these names: 2-{((5-chlorothiophen-2-yl)methyl)amino}acetic acid hydrochloride, 95%, 2-{((5-Chlorothiophen-2-yl)methyl)amino}acetic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-[(5-chlorothiophen-2-yl)methylamino]acetic acid;hydrochloride (CAS 1375473-06-5) is a chemical compound with the molecular formula C7H9Cl2NO2S and a molecular weight of 242.12 g/mol. IUPAC name: 2-[(5-chlorothiophen-2-yl)methylamino]acetic acid;hydrochloride. InChIKey: BOBIUMGUDDKVKV-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2NO2S |
|---|---|
| Molecular weight | 242.12 g/mol |
| IUPAC name | 2-[(5-chlorothiophen-2-yl)methylamino]acetic acid;hydrochloride |
| InChIKey | BOBIUMGUDDKVKV-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Cl)CNCC(=O)O.Cl |
Computed by PubChem (NCBI)