CAS 2446590-63-0 appears in our catalog under these names: 4,5-Dimethylpyridine-3-sulfonyl chloride hydrochloride, 98%, 4,5-Dimethylpyridine-3-sulfonyl chloride hydrochloride, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
4,5-dimethylpyridine-3-sulfonyl chloride;hydrochloride (CAS 2446590-63-0) is a chemical compound with the molecular formula C7H9Cl2NO2S and a molecular weight of 242.12 g/mol. IUPAC name: 4,5-dimethylpyridine-3-sulfonyl chloride;hydrochloride. InChIKey: AFUNTRMHEGUHGZ-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2NO2S |
|---|---|
| Molecular weight | 242.12 g/mol |
| IUPAC name | 4,5-dimethylpyridine-3-sulfonyl chloride;hydrochloride |
| InChIKey | AFUNTRMHEGUHGZ-UHFFFAOYSA-N |
| SMILES | CC1=CN=CC(=C1C)S(=O)(=O)Cl.Cl |
Computed by PubChem (NCBI)