CAS 194229-22-6 appears in our catalog under these names: 3-Amino-3-(5-chlorothiophen-2-yl)propanoic acid hydrochloride, 95%, 3-Amino-3-(5-chlorothiophen-2-yl)propanoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-amino-3-(5-chlorothiophen-2-yl)propanoic acid;hydrochloride (CAS 194229-22-6) is a chemical compound with the molecular formula C7H9Cl2NO2S and a molecular weight of 242.12 g/mol. IUPAC name: 3-amino-3-(5-chlorothiophen-2-yl)propanoic acid;hydrochloride. InChIKey: RYLXELDMJXHSRJ-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2NO2S |
|---|---|
| Molecular weight | 242.12 g/mol |
| IUPAC name | 3-amino-3-(5-chlorothiophen-2-yl)propanoic acid;hydrochloride |
| InChIKey | RYLXELDMJXHSRJ-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Cl)C(CC(=O)O)N.Cl |
Computed by PubChem (NCBI)