Products 147529-66-6

CAS 147529-66-6 appears in our catalog under these names: 2-(Pyridin-2-yl)ethane-1-sulfonyl chloride hydrochloride, 95%, 2-(Pyridin-2-yl)ethane-1-sulfonyl chloride hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-pyridin-2-ylethanesulfonyl chloride;hydrochloride (CAS 147529-66-6) is a chemical compound with the molecular formula C7H9Cl2NO2S and a molecular weight of 242.12 g/mol. IUPAC name: 2-pyridin-2-ylethanesulfonyl chloride;hydrochloride. InChIKey: GCYDUTOUEUWVAX-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9Cl2NO2S
Molecular weight242.12 g/mol
IUPAC name2-pyridin-2-ylethanesulfonyl chloride;hydrochloride
InChIKeyGCYDUTOUEUWVAX-UHFFFAOYSA-N
SMILESC1=CC=NC(=C1)CCS(=O)(=O)Cl.Cl

Computed by PubChem (NCBI)