CAS 2260931-75-5 is the registry number for 2-Amino-3-(5-chlorothiophen-3-yl)propanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-3-(5-chlorothiophen-3-yl)propanoic acid;hydrochloride (CAS 2260931-75-5) is a chemical compound with the molecular formula C7H9Cl2NO2S and a molecular weight of 242.12 g/mol. IUPAC name: 2-amino-3-(5-chlorothiophen-3-yl)propanoic acid;hydrochloride. InChIKey: FMULFGILYUWKNF-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2NO2S |
|---|---|
| Molecular weight | 242.12 g/mol |
| IUPAC name | 2-amino-3-(5-chlorothiophen-3-yl)propanoic acid;hydrochloride |
| InChIKey | FMULFGILYUWKNF-UHFFFAOYSA-N |
| SMILES | C1=C(SC=C1CC(C(=O)O)N)Cl.Cl |
Computed by PubChem (NCBI)