Products 2260931-75-5

CAS 2260931-75-5 is the registry number for 2-Amino-3-(5-chlorothiophen-3-yl)propanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-amino-3-(5-chlorothiophen-3-yl)propanoic acid;hydrochloride (CAS 2260931-75-5) is a chemical compound with the molecular formula C7H9Cl2NO2S and a molecular weight of 242.12 g/mol. IUPAC name: 2-amino-3-(5-chlorothiophen-3-yl)propanoic acid;hydrochloride. InChIKey: FMULFGILYUWKNF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9Cl2NO2S
Molecular weight242.12 g/mol
IUPAC name2-amino-3-(5-chlorothiophen-3-yl)propanoic acid;hydrochloride
InChIKeyFMULFGILYUWKNF-UHFFFAOYSA-N
SMILESC1=C(SC=C1CC(C(=O)O)N)Cl.Cl

Computed by PubChem (NCBI)