CAS 81705-92-2 is the registry number for 2-Pyridin-4-yl-ethanesulfonyl chloridehydrochloride. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-pyridin-4-ylethanesulfonyl chloride;hydrochloride (CAS 81705-92-2) is a chemical compound with the molecular formula C7H9Cl2NO2S and a molecular weight of 242.12 g/mol. IUPAC name: 2-pyridin-4-ylethanesulfonyl chloride;hydrochloride. InChIKey: HTLGIJSCZRCHCV-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2NO2S |
|---|---|
| Molecular weight | 242.12 g/mol |
| IUPAC name | 2-pyridin-4-ylethanesulfonyl chloride;hydrochloride |
| InChIKey | HTLGIJSCZRCHCV-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1CCS(=O)(=O)Cl.Cl |
Computed by PubChem (NCBI)