CAS 1376687-76-1 appears in our catalog under these names: (1S)-5-Chloro-2,3-dihydro-1h-inden-1-amine hydrochloride, 95%, (S)–5–Chloro–2,3–dihydro–1H–inden–1–amine hydrochloride, (S)-5-chloro-2,3-dihydro-1H-inden-1-amine hydrochloride, (S)-5-Chloro-2,3-dihydro-1H-inden-1-amine hydrochloride, 97%, 97%, (S)-5-Chloro-2,3-dihydro-1H-inden-1-amine hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 50mg, 0,5g, 5g.
(1S)-5-chloro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1376687-76-1) is a chemical compound with the molecular formula C9H11Cl2N and a molecular weight of 204.09 g/mol. IUPAC name: (1S)-5-chloro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: JRYBHXVWIQBARN-FVGYRXGTSA-N.
| Molecular formula | C9H11Cl2N |
|---|---|
| Molecular weight | 204.09 g/mol |
| IUPAC name | (1S)-5-chloro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | JRYBHXVWIQBARN-FVGYRXGTSA-N |
| SMILES | C1CC2=C([C@H]1N)C=CC(=C2)Cl.Cl |
Computed by PubChem (NCBI)