CAS 1637453-67-8 appears in our catalog under these names: (R)-5-Chloro-2,3-dihydro-1h-inden-1-amine hydrochloride, 95%, (R)-5-Chloro-2,3-dihydro-1H-inden-1-amine hydrochloride, 97%, (R)–5–Chloro–2,3–dihydro–1H–inden–1–amine hydrochloride, (R)-5-chloro-2,3-dihydro-1H-inden-1-amine hydrochloride, (R)-5-Chloro-2,3-dihydro-1H-inden-1-amine hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 100mg, 1g, 50mg, 5g, 0,5g.
(1R)-5-chloro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1637453-67-8) is a chemical compound with the molecular formula C9H11Cl2N and a molecular weight of 204.09 g/mol. IUPAC name: (1R)-5-chloro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: JRYBHXVWIQBARN-SBSPUUFOSA-N.
| Molecular formula | C9H11Cl2N |
|---|---|
| Molecular weight | 204.09 g/mol |
| IUPAC name | (1R)-5-chloro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | JRYBHXVWIQBARN-SBSPUUFOSA-N |
| SMILES | C1CC2=C([C@@H]1N)C=CC(=C2)Cl.Cl |
Computed by PubChem (NCBI)