Products 137820-87-2
CAS 137820-87-2 appears in our catalog under these names: 3a,6a-Dimethyltetrahydrocyclobuta[1,2-c:3,4-c']difuran-1,3,4,6-tetraone 95%, 1,3-Dimethyl-1,2,3,4-cyclobutanetetracarboxylic acid dianhydride, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 1g, 5g, 50g, 100g, 250mg, 10g, 25g.
1,6-dimethyl-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone (CAS 137820-87-2) is a chemical compound with the molecular formula C10H8O6 and a molecular weight of 224.17 g/mol. IUPAC name: 1,6-dimethyl-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone. InChIKey: LBCZLAVMELJZIY-UHFFFAOYSA-N.
| Molecular formula | C10H8O6 |
|---|---|
| Molecular weight | 224.17 g/mol |
| IUPAC name | 1,6-dimethyl-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
| InChIKey | LBCZLAVMELJZIY-UHFFFAOYSA-N |
| SMILES | CC12C(C(=O)OC1=O)C3(C2C(=O)OC3=O)C |
Computed by PubChem (NCBI)