CAS 34333-95-4 is the registry number for 1,2,3,4-Tetraoxo-1,2,3,4-tetrahydronaphthalene dihydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Naphthalene-1,2,3,4-tetrone;dihydrate (CAS 34333-95-4) is a chemical compound with the molecular formula C10H8O6 and a molecular weight of 224.17 g/mol. IUPAC name: naphthalene-1,2,3,4-tetrone;dihydrate. InChIKey: FSQMCMDIIWIYAQ-UHFFFAOYSA-N.
| Molecular formula | C10H8O6 |
|---|---|
| Molecular weight | 224.17 g/mol |
| IUPAC name | naphthalene-1,2,3,4-tetrone;dihydrate |
| InChIKey | FSQMCMDIIWIYAQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=O)C(=O)C2=O.O.O |
Computed by PubChem (NCBI)