CAS 18263-95-1 appears in our catalog under these names: 5-(Methoxycarbonyl)isophthalic acid, 95%, 95%, 5-(Methoxycarbonyl)isophthalic acid, 97%, 5-(Methoxycarbonyl)isophthalic acid. Offered by: Chemat, AmBeed, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 5g, 0,1g.
5-methoxycarbonylbenzene-1,3-dicarboxylic acid (CAS 18263-95-1) is a chemical compound with the molecular formula C10H8O6 and a molecular weight of 224.17 g/mol. IUPAC name: 5-methoxycarbonylbenzene-1,3-dicarboxylic acid. InChIKey: STBOKQUWWUFPAZ-UHFFFAOYSA-N.
| Molecular formula | C10H8O6 |
|---|---|
| Molecular weight | 224.17 g/mol |
| IUPAC name | 5-methoxycarbonylbenzene-1,3-dicarboxylic acid |
| InChIKey | STBOKQUWWUFPAZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)