CAS 32971-88-3 appears in our catalog under these names: Methyl–benzene–1,3,5–tricarboxylic acid, 2-methylbenzene-1,3,5-tricarboxylic acid, 95%, 95%, Methyl-benzene-1,3,5-tricarboxylic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
2-methylbenzene-1,3,5-tricarboxylic acid (CAS 32971-88-3) is a chemical compound with the molecular formula C10H8O6 and a molecular weight of 224.17 g/mol. IUPAC name: 2-methylbenzene-1,3,5-tricarboxylic acid. InChIKey: AYXZCFRWTIRMLY-UHFFFAOYSA-N.
| Molecular formula | C10H8O6 |
|---|---|
| Molecular weight | 224.17 g/mol |
| IUPAC name | 2-methylbenzene-1,3,5-tricarboxylic acid |
| InChIKey | AYXZCFRWTIRMLY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)