CAS 2754-41-8 appears in our catalog under these names: 1,2,4,5–Cyclohexanetetracarboxylic dianhydride, 1,2,4,5-Cyclohexanetetracarboxylic Dianhydride, >98.0%(T), 1,2,4,5-Cyclohexanetetracarboxylic Dianhydride (purified by sublimation), >98.0%(T), 1,2,4,5-Cyclohexanetetracarboxylic dianhydride, 95%, 1,2,4,5-Cyclohexanetetracarboxylic Dianhydride 95%. Offered by: GLPBio, TCI, Thermo Scientific (Acros), Ambeed, Chemat. Available pack sizes: 100g, 10g, 25g, 500g, 5g, 1g.
3a,4,4a,7a,8,8a-hexahydrofuro[3,4-f][2]benzofuran-1,3,5,7-tetrone (CAS 2754-41-8) is a chemical compound with the molecular formula C10H8O6 and a molecular weight of 224.17 g/mol. IUPAC name: 3a,4,4a,7a,8,8a-hexahydrofuro[3,4-f][2]benzofuran-1,3,5,7-tetrone. InChIKey: LJMPOXUWPWEILS-UHFFFAOYSA-N.
| Molecular formula | C10H8O6 |
|---|---|
| Molecular weight | 224.17 g/mol |
| IUPAC name | 3a,4,4a,7a,8,8a-hexahydrofuro[3,4-f][2]benzofuran-1,3,5,7-tetrone |
| InChIKey | LJMPOXUWPWEILS-UHFFFAOYSA-N |
| SMILES | C1C2C(CC3C1C(=O)OC3=O)C(=O)OC2=O |
Computed by PubChem (NCBI)