CAS 6053-46-9 appears in our catalog under these names: Tetrahydro-1h-5,9-methanopyrano[3,4-d]oxepine-1,3,6,8(4h)-tetraone, 97%, 3–(Carboxymethyl)–1,2,4–cyclopentanetricarboxylic acid 1,4:2,3–dianhydride, 3-(Carboxymethyl)-1,2,4-cyclopentanetricarboxylic Acid 1,4:2,3-Dianhydride, >97.0%(T), Tetrahydro-1H-5,9-methanopyrano[3,4-d]oxepine-1,3,6,8(4H)-tetraone, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
4,10-dioxatricyclo[6.3.1.02,7]dodecane-3,5,9,11-tetrone (CAS 6053-46-9) is a chemical compound with the molecular formula C10H8O6 and a molecular weight of 224.17 g/mol. IUPAC name: 4,10-dioxatricyclo[6.3.1.02,7]dodecane-3,5,9,11-tetrone. InChIKey: QVEIRZNRYOJFCL-UHFFFAOYSA-N.
| Molecular formula | C10H8O6 |
|---|---|
| Molecular weight | 224.17 g/mol |
| IUPAC name | 4,10-dioxatricyclo[6.3.1.02,7]dodecane-3,5,9,11-tetrone |
| InChIKey | QVEIRZNRYOJFCL-UHFFFAOYSA-N |
| SMILES | C1C2C3CC(=O)OC(=O)C3C1C(=O)OC2=O |
Computed by PubChem (NCBI)