CAS 13788-94-8 is the registry number for 3,5-Dimethyl-1-(4-nitrophenyl)pyrazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
3,5-dimethyl-1-(4-nitrophenyl)pyrazole (CAS 13788-94-8) is a chemical compound with the molecular formula C11H11N3O2 and a molecular weight of 217.22 g/mol. IUPAC name: 3,5-dimethyl-1-(4-nitrophenyl)pyrazole. InChIKey: ULPBJGVRVXWECP-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O2 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 3,5-dimethyl-1-(4-nitrophenyl)pyrazole |
| InChIKey | ULPBJGVRVXWECP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CC=C(C=C2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)