CAS 1378815-29-2 is the registry number for 6-Chloro-1h-pyrazolo[4,3-b]pyridine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-chloro-1H-pyrazolo[4,3-b]pyridine-3-carboxylic acid (CAS 1378815-29-2) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 6-chloro-1H-pyrazolo[4,3-b]pyridine-3-carboxylic acid. InChIKey: LPTOIVKVFBFTLM-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 6-chloro-1H-pyrazolo[4,3-b]pyridine-3-carboxylic acid |
| InChIKey | LPTOIVKVFBFTLM-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1NN=C2C(=O)O)Cl |
Computed by PubChem (NCBI)