Products 1378815-29-2

CAS 1378815-29-2 is the registry number for 6-Chloro-1h-pyrazolo[4,3-b]pyridine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

6-chloro-1H-pyrazolo[4,3-b]pyridine-3-carboxylic acid (CAS 1378815-29-2) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 6-chloro-1H-pyrazolo[4,3-b]pyridine-3-carboxylic acid. InChIKey: LPTOIVKVFBFTLM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4ClN3O2
Molecular weight197.58 g/mol
IUPAC name6-chloro-1H-pyrazolo[4,3-b]pyridine-3-carboxylic acid
InChIKeyLPTOIVKVFBFTLM-UHFFFAOYSA-N
SMILESC1=C(C=NC2=C1NN=C2C(=O)O)Cl

Computed by PubChem (NCBI)