Products 1378827-29-2
CAS 1378827-29-2 is the registry number for 3-(Cyanomethyl)-4-fluorobenzoic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-(cyanomethyl)-4-fluorobenzoic acid (CAS 1378827-29-2) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 3-(cyanomethyl)-4-fluorobenzoic acid. InChIKey: DNSYISWEBRJUKQ-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 3-(cyanomethyl)-4-fluorobenzoic acid |
| InChIKey | DNSYISWEBRJUKQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)CC#N)F |
Computed by PubChem (NCBI)