CAS 13790-39-1 appears in our catalog under these names: 4-Chloro-6,7-dimethoxyquinazoline, 4–Chloro–6,7–dimethoxyquinazoline, 4-Chloro-6,7-dimethoxyquinazoline, 98% , 4-Chloro-6,7-dimethoxyquinazoline, >98.0%(HPLC)(N), 4-Chloro-6,7-dimethoxyquinazoline 98%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 10g, 2,5g, 5g, 25g, 1g, 100g, 500g, 10 g.
4-chloro-6,7-dimethoxyquinazoline (CAS 13790-39-1) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: 4-chloro-6,7-dimethoxyquinazoline. InChIKey: LLLHRNQLGUOJHP-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 4-chloro-6,7-dimethoxyquinazoline |
| InChIKey | LLLHRNQLGUOJHP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)Cl)OC |
Computed by PubChem (NCBI)